C20H19ClNO4P — CID 91435902
[chloro(naphthalen-1-yl)phosphoryl] (2S)-2-(phenylmethoxyamino)propanoate (PubChem CID 91435902) has the molecular formula C20H19ClNO4P and a molecular weight of 403.80 g/mol. Its IUPAC name is [chloro(naphthalen-1-yl)phosphoryl] (2S)-2-(phenylmethoxyamino)propanoate.
| Compound Name | [chloro(naphthalen-1-yl)phosphoryl] (2S)-2-(phenylmethoxyamino)propanoate |
|---|---|
| PubChem CID | 91435902 |
| Molecular Formula | C20H19ClNO4P |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [chloro(naphthalen-1-yl)phosphoryl] (2S)-2-(phenylmethoxyamino)propanoate |
| SMILES | C[C@H](NOCc1ccccc1)C(=O)OP(=O)(Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H19ClNO4P/c1-15(22-25-14-16-8-3-2-4-9-16)20(23)26-27(21,24)19-13-7-11-17-10-5-6-12-18(17)19/h2-13,15,22H,14H2,1H3/t15-,27?/m0/s1 |
| InChIKey | JKJXHLCGITVFAD-JCHGGWTISA-N |
| XLogP | 4.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|