C11H15ClNO5P — CID 20598733
chloro-[(2S)-2-(2-phenylethoxyamino)propanoyl]oxyphosphinic acid (PubChem CID 20598733) has the molecular formula C11H15ClNO5P and a molecular weight of 307.67 g/mol. Its IUPAC name is chloro-[(2S)-2-(2-phenylethoxyamino)propanoyl]oxyphosphinic acid.
| Compound Name | chloro-[(2S)-2-(2-phenylethoxyamino)propanoyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 20598733 |
| Molecular Formula | C11H15ClNO5P |
| Molecular Weight | 307.67 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | chloro-[(2S)-2-(2-phenylethoxyamino)propanoyl]oxyphosphinic acid |
| SMILES | C[C@H](NOCCc1ccccc1)C(=O)OP(=O)(O)Cl |
| InChI | InChI=1S/C11H15ClNO5P/c1-9(11(14)18-19(12,15)16)13-17-8-7-10-5-3-2-4-6-10/h2-6,9,13H,7-8H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | YBHNTRDCWWXVTE-VIFPVBQESA-N |
| XLogP | 2.02 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|