C20H25ClNO6P — CID 88548153
chloro-[(2S)-2-(4-methoxy-N-phenylmethoxyanilino)-4-methylpentanoyl]oxyphosphinic acid (PubChem CID 88548153) has the molecular formula C20H25ClNO6P and a molecular weight of 441.85 g/mol. Its IUPAC name is chloro-[(2S)-2-(4-methoxy-N-phenylmethoxyanilino)-4-methylpentanoyl]oxyphosphinic acid.
| Compound Name | chloro-[(2S)-2-(4-methoxy-N-phenylmethoxyanilino)-4-methylpentanoyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 88548153 |
| Molecular Formula | C20H25ClNO6P |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | chloro-[(2S)-2-(4-methoxy-N-phenylmethoxyanilino)-4-methylpentanoyl]oxyphosphinic acid |
| SMILES | COc1ccc(N(OCc2ccccc2)[C@@H](CC(C)C)C(=O)OP(=O)(O)Cl)cc1 |
| InChI | InChI=1S/C20H25ClNO6P/c1-15(2)13-19(20(23)28-29(21,24)25)22(17-9-11-18(26-3)12-10-17)27-14-16-7-5-4-6-8-16/h4-12,15,19H,13-14H2,1-3H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | JZOMLTXGXJHLIW-IBGZPJMESA-N |
| XLogP | 4.93 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|