C18H21ClNO6P — CID 88548285
chloro-[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)-2-phenylmethoxyacetyl]oxyphosphinic acid (PubChem CID 88548285) has the molecular formula C18H21ClNO6P and a molecular weight of 413.79 g/mol. Its IUPAC name is chloro-[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)-2-phenylmethoxyacetyl]oxyphosphinic acid.
| Compound Name | chloro-[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)-2-phenylmethoxyacetyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 88548285 |
| Molecular Formula | C18H21ClNO6P |
| Molecular Weight | 413.79 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | chloro-[(2S)-2-(dimethylamino)-2-(4-methoxyphenyl)-2-phenylmethoxyacetyl]oxyphosphinic acid |
| SMILES | COc1ccc([C@](OCc2ccccc2)(C(=O)OP(=O)(O)Cl)N(C)C)cc1 |
| InChI | InChI=1S/C18H21ClNO6P/c1-20(2)18(17(21)26-27(19,22)23,15-9-11-16(24-3)12-10-15)25-13-14-7-5-4-6-8-14/h4-12H,13H2,1-3H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | IKQNWYFGEACOBZ-SFHVURJKSA-N |
| XLogP | 3.51 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|