C10H13ClNO5P — CID 87646166
chloro-[(2R)-2-(phenylmethoxyamino)propanoyl]oxyphosphinic acid (PubChem CID 87646166) has the molecular formula C10H13ClNO5P and a molecular weight of 293.64 g/mol. Its IUPAC name is chloro-[(2R)-2-(phenylmethoxyamino)propanoyl]oxyphosphinic acid.
| Compound Name | chloro-[(2R)-2-(phenylmethoxyamino)propanoyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 87646166 |
| Molecular Formula | C10H13ClNO5P |
| Molecular Weight | 293.64 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | chloro-[(2R)-2-(phenylmethoxyamino)propanoyl]oxyphosphinic acid |
| SMILES | C[C@@H](NOCc1ccccc1)C(=O)OP(=O)(O)Cl |
| InChI | InChI=1S/C10H13ClNO5P/c1-8(10(13)17-18(11,14)15)12-16-7-9-5-3-2-4-6-9/h2-6,8,12H,7H2,1H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | VLFFKWUMBJMTPP-MRVPVSSYSA-N |
| XLogP | 1.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.64 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|