C20H23Cl4N3O4P2 — CID 174923715
1-[chloro(phenyl)phosphoryl]-2-(phenylmethoxyamino)propan-1-one;2-methyl-1H-imidazole;phosphoryl trichloride (PubChem CID 174923715) has the molecular formula C20H23Cl4N3O4P2 and a molecular weight of 573.18 g/mol. Its IUPAC name is 1-[chloro(phenyl)phosphoryl]-2-(phenylmethoxyamino)propan-1-one;2-methyl-1H-imidazole;phosphoryl trichloride.
| Compound Name | 1-[chloro(phenyl)phosphoryl]-2-(phenylmethoxyamino)propan-1-one;2-methyl-1H-imidazole;phosphoryl trichloride |
|---|---|
| PubChem CID | 174923715 |
| Molecular Formula | C20H23Cl4N3O4P2 |
| Molecular Weight | 573.18 g/mol |
| Exact Mass | 570.99 |
| IUPAC Name | 1-[chloro(phenyl)phosphoryl]-2-(phenylmethoxyamino)propan-1-one;2-methyl-1H-imidazole;phosphoryl trichloride |
| SMILES | CC(NOCc1ccccc1)C(=O)P(=O)(Cl)c1ccccc1.Cc1ncc[nH]1.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H17ClNO3P.C4H6N2.Cl3OP/c1-13(18-21-12-14-8-4-2-5-9-14)16(19)22(17,20)15-10-6-3-7-11-15;1-4-5-2-3-6-4;1-5(2,3)4/h2-11,13,18H,12H2,1H3;2-3H,1H3,(H,5,6); |
| InChIKey | JHYPLKUEDQSERC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.18 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|