C16H14ClF3NO5P — CID 87294431
chloro-[(2S)-2-[[4-(2,3,4-trifluorophenyl)phenyl]methoxyamino]propanoyl]oxyphosphinic acid (PubChem CID 87294431) has the molecular formula C16H14ClF3NO5P and a molecular weight of 423.71 g/mol. Its IUPAC name is chloro-[(2S)-2-[[4-(2,3,4-trifluorophenyl)phenyl]methoxyamino]propanoyl]oxyphosphinic acid.
| Compound Name | chloro-[(2S)-2-[[4-(2,3,4-trifluorophenyl)phenyl]methoxyamino]propanoyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 87294431 |
| Molecular Formula | C16H14ClF3NO5P |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | chloro-[(2S)-2-[[4-(2,3,4-trifluorophenyl)phenyl]methoxyamino]propanoyl]oxyphosphinic acid |
| SMILES | C[C@H](NOCc1ccc(-c2ccc(F)c(F)c2F)cc1)C(=O)OP(=O)(O)Cl |
| InChI | InChI=1S/C16H14ClF3NO5P/c1-9(16(22)26-27(17,23)24)21-25-8-10-2-4-11(5-3-10)12-6-7-13(18)15(20)14(12)19/h2-7,9,21H,8H2,1H3,(H,23,24)/t9-/m0/s1 |
| InChIKey | REFZVBLPUGQKHO-VIFPVBQESA-N |
| XLogP | 4.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|