C20H15Cl3FN3O3 — CID 59471265
4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-N-[(4-chlorophenyl)methoxy]pyridine-2-carboxamide (PubChem CID 59471265) has the molecular formula C20H15Cl3FN3O3 and a molecular weight of 470.72 g/mol. Its IUPAC name is 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-N-[(4-chlorophenyl)methoxy]pyridine-2-carboxamide.
| Compound Name | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-N-[(4-chlorophenyl)methoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59471265 |
| Molecular Formula | C20H15Cl3FN3O3 |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-N-[(4-chlorophenyl)methoxy]pyridine-2-carboxamide |
| SMILES | COc1c(Cl)ccc(-c2cc(N)c(Cl)c(C(=O)NOCc3ccc(Cl)cc3)n2)c1F |
| InChI | InChI=1S/C20H15Cl3FN3O3/c1-29-19-13(22)7-6-12(17(19)24)15-8-14(25)16(23)18(26-15)20(28)27-30-9-10-2-4-11(21)5-3-10/h2-8H,9H2,1H3,(H2,25,26)(H,27,28) |
| InChIKey | YIQIREOMSWXAJE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|