C24H24O5 — CID 10894477
(4-methoxyphenyl) (2S,3R)-3-hydroxy-2-methyl-3-phenyl-2-phenylmethoxypropanoate (PubChem CID 10894477) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is (4-methoxyphenyl) (2S,3R)-3-hydroxy-2-methyl-3-phenyl-2-phenylmethoxypropanoate.
| Compound Name | (4-methoxyphenyl) (2S,3R)-3-hydroxy-2-methyl-3-phenyl-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 10894477 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (4-methoxyphenyl) (2S,3R)-3-hydroxy-2-methyl-3-phenyl-2-phenylmethoxypropanoate |
| SMILES | COc1ccc(OC(=O)[C@@](C)(OCc2ccccc2)[C@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O5/c1-24(22(25)19-11-7-4-8-12-19,28-17-18-9-5-3-6-10-18)23(26)29-21-15-13-20(27-2)14-16-21/h3-16,22,25H,17H2,1-2H3/t22-,24+/m1/s1 |
| InChIKey | IDFWULQPCKLVJA-VWNXMTODSA-N |
| XLogP | 4.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|