C20H24O3S2 — CID 135267555
(3S)-3-[(4-methoxyphenyl)-sulfanylmethyl]sulfanyl-3-methyl-4-phenylmethoxybutan-2-one (PubChem CID 135267555) has the molecular formula C20H24O3S2 and a molecular weight of 376.54 g/mol. Its IUPAC name is (3S)-3-[(4-methoxyphenyl)-sulfanylmethyl]sulfanyl-3-methyl-4-phenylmethoxybutan-2-one.
| Compound Name | (3S)-3-[(4-methoxyphenyl)-sulfanylmethyl]sulfanyl-3-methyl-4-phenylmethoxybutan-2-one |
|---|---|
| PubChem CID | 135267555 |
| Molecular Formula | C20H24O3S2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (3S)-3-[(4-methoxyphenyl)-sulfanylmethyl]sulfanyl-3-methyl-4-phenylmethoxybutan-2-one |
| SMILES | COc1ccc(C(S)S[C@@](C)(COCc2ccccc2)C(C)=O)cc1 |
| InChI | InChI=1S/C20H24O3S2/c1-15(21)20(2,14-23-13-16-7-5-4-6-8-16)25-19(24)17-9-11-18(22-3)12-10-17/h4-12,19,24H,13-14H2,1-3H3/t19?,20-/m0/s1 |
| InChIKey | SKARDDZVWJICSU-ANYOKISRSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|