C30H42N2O5 — CID 102263092
(3R,4S)-4-[(E)-3-[(4-methoxyphenyl)methoxy]prop-1-enyl]-N,N,N',N',3-pentamethyl-3-(phenylmethoxymethyl)hexanediamide (PubChem CID 102263092) has the molecular formula C30H42N2O5 and a molecular weight of 510.68 g/mol. Its IUPAC name is (3R,4S)-4-[(E)-3-[(4-methoxyphenyl)methoxy]prop-1-enyl]-N,N,N',N',3-pentamethyl-3-(phenylmethoxymethyl)hexanediamide.
| Compound Name | (3R,4S)-4-[(E)-3-[(4-methoxyphenyl)methoxy]prop-1-enyl]-N,N,N',N',3-pentamethyl-3-(phenylmethoxymethyl)hexanediamide |
|---|---|
| PubChem CID | 102263092 |
| Molecular Formula | C30H42N2O5 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (3R,4S)-4-[(E)-3-[(4-methoxyphenyl)methoxy]prop-1-enyl]-N,N,N',N',3-pentamethyl-3-(phenylmethoxymethyl)hexanediamide |
| SMILES | COc1ccc(COC/C=C/[C@H](CC(=O)N(C)C)[C@](C)(COCc2ccccc2)CC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C30H42N2O5/c1-30(20-29(34)32(4)5,23-37-22-24-11-8-7-9-12-24)26(19-28(33)31(2)3)13-10-18-36-21-25-14-16-27(35-6)17-15-25/h7-17,26H,18-23H2,1-6H3/b13-10+/t26-,30+/m1/s1 |
| InChIKey | XHBVZJPAXLFAJZ-DOARKPOPSA-N |
| XLogP | 4.56 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|