About [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate
[(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate (PubChem CID 140503961) has the molecular formula C14H16N2O4
and a molecular weight of 276.29 g/mol. Its IUPAC name is [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate.
Molecular Properties
| Compound Name | [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate |
| PubChem CID | 140503961 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate |
| SMILES | COc1ccc(COC/C=C/COC(=O)C=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-18-13-6-4-12(5-7-13)11-19-8-2-3-9-20-14(17)10-16-15/h2-7,10H,8-9,11H2,1H3/b3-2+ |
| InChIKey | FYJPUHPICHMZEV-NSCUHMNNSA-N |
| XLogP | 1.61 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate?
The IUPAC name of [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate (CID 140503961) is [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate.
What is the SMILES notation for [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate?
The canonical SMILES for [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate is COc1ccc(COC/C=C/COC(=O)C=[N+]=[N-])cc1.
What is the InChIKey of [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate?
The InChIKey is FYJPUHPICHMZEV-NSCUHMNNSA-N. The full InChI is InChI=1S/C14H16N2O4/c1-18-13-6-4-12(5-7-13)11-19-8-2-3-9-20-14(17)10-16-15/h2-7,10H,8-9,11H2,1H3/b3-2+.
What are the key properties of [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate?
[(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate has a molecular weight of 276.29 g/mol, XLogP of 1.61, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-[(4-methoxyphenyl)methoxy]but-2-enyl] 2-diazoacetate is sourced from PubChem (CID 140503961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).