C14H18N2O4 — CID 101167216
[(2R,4S)-4-(4-methoxyphenoxy)pentan-2-yl] 2-diazoacetate (PubChem CID 101167216) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [(2R,4S)-4-(4-methoxyphenoxy)pentan-2-yl] 2-diazoacetate.
| Compound Name | [(2R,4S)-4-(4-methoxyphenoxy)pentan-2-yl] 2-diazoacetate |
|---|---|
| PubChem CID | 101167216 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [(2R,4S)-4-(4-methoxyphenoxy)pentan-2-yl] 2-diazoacetate |
| SMILES | COc1ccc(O[C@@H](C)C[C@@H](C)OC(=O)C=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H18N2O4/c1-10(8-11(2)20-14(17)9-16-15)19-13-6-4-12(18-3)5-7-13/h4-7,9-11H,8H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | YEGJBZLQBQSBPX-WDEREUQCSA-N |
| XLogP | 2.08 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|