C38H50O6 — CID 101246360
(3S,4R,6R,7S,8R,9R)-7-hydroxy-9-[(4-methoxyphenyl)methoxy]-2,4,6,8,10-pentamethyl-3,4-bis(phenylmethoxy)undec-1-en-5-one (PubChem CID 101246360) has the molecular formula C38H50O6 and a molecular weight of 602.81 g/mol. Its IUPAC name is (3S,4R,6R,7S,8R,9R)-7-hydroxy-9-[(4-methoxyphenyl)methoxy]-2,4,6,8,10-pentamethyl-3,4-bis(phenylmethoxy)undec-1-en-5-one.
| Compound Name | (3S,4R,6R,7S,8R,9R)-7-hydroxy-9-[(4-methoxyphenyl)methoxy]-2,4,6,8,10-pentamethyl-3,4-bis(phenylmethoxy)undec-1-en-5-one |
|---|---|
| PubChem CID | 101246360 |
| Molecular Formula | C38H50O6 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | (3S,4R,6R,7S,8R,9R)-7-hydroxy-9-[(4-methoxyphenyl)methoxy]-2,4,6,8,10-pentamethyl-3,4-bis(phenylmethoxy)undec-1-en-5-one |
| SMILES | C=C(C)[C@H](OCc1ccccc1)[C@@](C)(OCc1ccccc1)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@H](OCc1ccc(OC)cc1)C(C)C |
| InChI | InChI=1S/C38H50O6/c1-26(2)35(42-23-32-19-21-33(41-8)22-20-32)28(5)34(39)29(6)36(40)38(7,44-25-31-17-13-10-14-18-31)37(27(3)4)43-24-30-15-11-9-12-16-30/h9-22,26,28-29,34-35,37,39H,3,23-25H2,1-2,4-8H3/t28-,29-,34+,35-,37+,38+/m1/s1 |
| InChIKey | VDTZETOECHXRJK-PDMNLNDWSA-N |
| XLogP | 7.58 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|