C25H32N2O9 — CID 88548257
[(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (2S)-2-(4-methoxy-N-phenylmethoxyanilino)propanoate (PubChem CID 88548257) has the molecular formula C25H32N2O9 and a molecular weight of 504.54 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (2S)-2-(4-methoxy-N-phenylmethoxyanilino)propanoate.
| Compound Name | [(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (2S)-2-(4-methoxy-N-phenylmethoxyanilino)propanoate |
|---|---|
| PubChem CID | 88548257 |
| Molecular Formula | C25H32N2O9 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | [(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (2S)-2-(4-methoxy-N-phenylmethoxyanilino)propanoate |
| SMILES | COc1ccc(N(OCc2ccccc2)[C@@H](C)C(=O)O[C@H]2[C@H](O)[C@@H](CO)OC(O)[C@@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C25H32N2O9/c1-15(24(31)36-23-21(26-16(2)29)25(32)35-20(13-28)22(23)30)27(18-9-11-19(33-3)12-10-18)34-14-17-7-5-4-6-8-17/h4-12,15,20-23,25,28,30,32H,13-14H2,1-3H3,(H,26,29)/t15-,20+,21+,22+,23+,25?/m0/s1 |
| InChIKey | DSYQZVDSTWUTLP-UGAJBOQPSA-N |
| XLogP | 0.51 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|