C26H38N3O12P — CID 88548256
[(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (2S)-2-(4-methoxy-N-phenylmethoxyanilino)propanoate;methoxyphosphonamidic acid (PubChem CID 88548256) has the molecular formula C26H38N3O12P and a molecular weight of 615.57 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (2S)-2-(4-methoxy-N-phenylmethoxyanilino)propanoate;methoxyphosphonamidic acid.
| Compound Name | [(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (2S)-2-(4-methoxy-N-phenylmethoxyanilino)propanoate;methoxyphosphonamidic acid |
|---|---|
| PubChem CID | 88548256 |
| Molecular Formula | C26H38N3O12P |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | [(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] (2S)-2-(4-methoxy-N-phenylmethoxyanilino)propanoate;methoxyphosphonamidic acid |
| SMILES | COP(N)(=O)O.COc1ccc(N(OCc2ccccc2)[C@@H](C)C(=O)O[C@H]2[C@H](O)[C@@H](CO)OC(O)[C@@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C25H32N2O9.CH6NO3P/c1-15(24(31)36-23-21(26-16(2)29)25(32)35-20(13-28)22(23)30)27(18-9-11-19(33-3)12-10-18)34-14-17-7-5-4-6-8-17;1-5-6(2,3)4/h4-12,15,20-23,25,28,30,32H,13-14H2,1-3H3,(H,26,29);1H3,(H3,2,3,4)/t15-,20+,21+,22+,23+,25?;/m0./s1 |
| InChIKey | MUSPGIKZSLUAMB-YFQSLEGVSA-N |
| XLogP | 0.20 |
| TPSA | 219.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|