C26H35N2O11P — CID 25108471
benzyl 2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-2-methylpropanoate (PubChem CID 25108471) has the molecular formula C26H35N2O11P and a molecular weight of 582.54 g/mol. Its IUPAC name is benzyl 2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-2-methylpropanoate.
| Compound Name | benzyl 2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 25108471 |
| Molecular Formula | C26H35N2O11P |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | benzyl 2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-2-methylpropanoate |
| SMILES | COc1ccc(OP(=O)(NC(C)(C)C(=O)OCc2ccccc2)OC[C@H]2O[C@H](O)[C@H](NC(C)=O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C26H35N2O11P/c1-16(29)27-21-23(31)22(30)20(38-24(21)32)15-37-40(34,39-19-12-10-18(35-4)11-13-19)28-26(2,3)25(33)36-14-17-8-6-5-7-9-17/h5-13,20-24,30-32H,14-15H2,1-4H3,(H,27,29)(H,28,34)/t20-,21-,22-,23-,24+,40?/m1/s1 |
| InChIKey | BDWPVYROVGDFJY-KBUFCKMOSA-N |
| XLogP | 1.25 |
| TPSA | 182.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|