C27H37N2O11PS — CID 25108356
benzyl (2S)-2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-4-methylsulfanylbutanoate (PubChem CID 25108356) has the molecular formula C27H37N2O11PS and a molecular weight of 628.64 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-4-methylsulfanylbutanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 25108356 |
| Molecular Formula | C27H37N2O11PS |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 628.19 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]-4-methylsulfanylbutanoate |
| SMILES | COc1ccc(OP(=O)(N[C@@H](CCSC)C(=O)OCc2ccccc2)OC[C@H]2O[C@H](O)[C@H](NC(C)=O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C27H37N2O11PS/c1-17(30)28-23-25(32)24(31)22(39-27(23)34)16-38-41(35,40-20-11-9-19(36-2)10-12-20)29-21(13-14-42-3)26(33)37-15-18-7-5-4-6-8-18/h4-12,21-25,27,31-32,34H,13-16H2,1-3H3,(H,28,30)(H,29,35)/t21-,22+,23+,24+,25+,27-,41?/m0/s1 |
| InChIKey | DKONISLAZWQZQR-FJXBSQKYSA-N |
| XLogP | 1.60 |
| TPSA | 182.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|