C19H29N2O11P — CID 25108409
ethyl 2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]acetate (PubChem CID 25108409) has the molecular formula C19H29N2O11P and a molecular weight of 492.42 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 25108409 |
| Molecular Formula | C19H29N2O11P |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | ethyl 2-[[[(2R,3S,4R,5R,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy-(4-methoxyphenoxy)phosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(=O)(OC[C@H]1O[C@H](O)[C@H](NC(C)=O)[C@@H](O)[C@@H]1O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H29N2O11P/c1-4-29-15(23)9-20-33(27,32-13-7-5-12(28-3)6-8-13)30-10-14-17(24)18(25)16(19(26)31-14)21-11(2)22/h5-8,14,16-19,24-26H,4,9-10H2,1-3H3,(H,20,27)(H,21,22)/t14-,16-,17-,18-,19+,33?/m1/s1 |
| InChIKey | MJFOTGWHUBJMNH-LFPYFHDHSA-N |
| XLogP | -0.70 |
| TPSA | 182.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|