C18H22NO4P — CID 143327358
benzyl 2-methyl-2-[[methyl(phenoxy)phosphoryl]amino]propanoate (PubChem CID 143327358) has the molecular formula C18H22NO4P and a molecular weight of 347.35 g/mol. Its IUPAC name is benzyl 2-methyl-2-[[methyl(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | benzyl 2-methyl-2-[[methyl(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 143327358 |
| Molecular Formula | C18H22NO4P |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | benzyl 2-methyl-2-[[methyl(phenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)(NP(C)(=O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H22NO4P/c1-18(2,17(20)22-14-15-10-6-4-7-11-15)19-24(3,21)23-16-12-8-5-9-13-16/h4-13H,14H2,1-3H3,(H,19,21) |
| InChIKey | XKXFBUKLGAHPIL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|