C30H38NO5P — CID 53323959
benzyl N-[(1S)-1-bis(4-tert-butylphenoxy)phosphorylethyl]carbamate (PubChem CID 53323959) has the molecular formula C30H38NO5P and a molecular weight of 523.61 g/mol. Its IUPAC name is benzyl N-[(1S)-1-bis(4-tert-butylphenoxy)phosphorylethyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-bis(4-tert-butylphenoxy)phosphorylethyl]carbamate |
|---|---|
| PubChem CID | 53323959 |
| Molecular Formula | C30H38NO5P |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | benzyl N-[(1S)-1-bis(4-tert-butylphenoxy)phosphorylethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OCc1ccccc1)P(=O)(Oc1ccc(C(C)(C)C)cc1)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H38NO5P/c1-22(31-28(32)34-21-23-11-9-8-10-12-23)37(33,35-26-17-13-24(14-18-26)29(2,3)4)36-27-19-15-25(16-20-27)30(5,6)7/h8-20,22H,21H2,1-7H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | BCVQSNPEJKFHSP-QFIPXVFZSA-N |
| XLogP | 8.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|