C14H21ClNO6P — CID 88548354
chloro-[(2S)-2-(N-ethoxy-4-methoxyanilino)pentanoyl]oxyphosphinic acid (PubChem CID 88548354) has the molecular formula C14H21ClNO6P and a molecular weight of 365.75 g/mol. Its IUPAC name is chloro-[(2S)-2-(N-ethoxy-4-methoxyanilino)pentanoyl]oxyphosphinic acid.
| Compound Name | chloro-[(2S)-2-(N-ethoxy-4-methoxyanilino)pentanoyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 88548354 |
| Molecular Formula | C14H21ClNO6P |
| Molecular Weight | 365.75 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | chloro-[(2S)-2-(N-ethoxy-4-methoxyanilino)pentanoyl]oxyphosphinic acid |
| SMILES | CCC[C@@H](C(=O)OP(=O)(O)Cl)N(OCC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H21ClNO6P/c1-4-6-13(14(17)22-23(15,18)19)16(21-5-2)11-7-9-12(20-3)10-8-11/h7-10,13H,4-6H2,1-3H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | KMHMPALDKWCOIH-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|