C12H12ClNO2 — CID 115665138
4-chloro-2-hydroxy-N-pent-4-yn-2-ylbenzamide (PubChem CID 115665138) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 4-chloro-2-hydroxy-N-pent-4-yn-2-ylbenzamide.
| Compound Name | 4-chloro-2-hydroxy-N-pent-4-yn-2-ylbenzamide |
|---|---|
| PubChem CID | 115665138 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-chloro-2-hydroxy-N-pent-4-yn-2-ylbenzamide |
| SMILES | C#CCC(C)NC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C12H12ClNO2/c1-3-4-8(2)14-12(16)10-6-5-9(13)7-11(10)15/h1,5-8,15H,4H2,2H3,(H,14,16) |
| InChIKey | UGYICUSJSIEXGC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|