C11H12ClNO5 — CID 43405857
methyl 2-[(4-chloro-2-hydroxybenzoyl)amino]-3-hydroxypropanoate (PubChem CID 43405857) has the molecular formula C11H12ClNO5 and a molecular weight of 273.67 g/mol. Its IUPAC name is methyl 2-[(4-chloro-2-hydroxybenzoyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(4-chloro-2-hydroxybenzoyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43405857 |
| Molecular Formula | C11H12ClNO5 |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | methyl 2-[(4-chloro-2-hydroxybenzoyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C11H12ClNO5/c1-18-11(17)8(5-14)13-10(16)7-3-2-6(12)4-9(7)15/h2-4,8,14-15H,5H2,1H3,(H,13,16) |
| InChIKey | VAPMBBVUNIMEND-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |