C14H16Cl2N2O4 — CID 54120863
methyl 6-amino-2-[(2,4-dichlorobenzoyl)amino]-6-oxohexanoate (PubChem CID 54120863) has the molecular formula C14H16Cl2N2O4 and a molecular weight of 347.20 g/mol. Its IUPAC name is methyl 6-amino-2-[(2,4-dichlorobenzoyl)amino]-6-oxohexanoate.
| Compound Name | methyl 6-amino-2-[(2,4-dichlorobenzoyl)amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 54120863 |
| Molecular Formula | C14H16Cl2N2O4 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | methyl 6-amino-2-[(2,4-dichlorobenzoyl)amino]-6-oxohexanoate |
| SMILES | COC(=O)C(CCCC(N)=O)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O4/c1-22-14(21)11(3-2-4-12(17)19)18-13(20)9-6-5-8(15)7-10(9)16/h5-7,11H,2-4H2,1H3,(H2,17,19)(H,18,20) |
| InChIKey | OCBNROLTATZQFL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |