C30H27Cl2NO6 — CID 70585288
propan-2-yl N-[1,2-bis[4-(4-chlorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 70585288) has the molecular formula C30H27Cl2NO6 and a molecular weight of 568.45 g/mol. Its IUPAC name is propan-2-yl N-[1,2-bis[4-(4-chlorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | propan-2-yl N-[1,2-bis[4-(4-chlorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 70585288 |
| Molecular Formula | C30H27Cl2NO6 |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | propan-2-yl N-[1,2-bis[4-(4-chlorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | CC(C)OC(=O)NC(COc1ccc(Oc2ccc(Cl)cc2)cc1)Oc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H27Cl2NO6/c1-20(2)36-30(34)33-29(39-28-17-15-27(16-18-28)38-25-9-5-22(32)6-10-25)19-35-23-11-13-26(14-12-23)37-24-7-3-21(31)4-8-24/h3-18,20,29H,19H2,1-2H3,(H,33,34) |
| InChIKey | DXSZFCKKPGDSAB-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|