C10H11ClO3 — CID 10353214
(2S)-3-(4-chlorophenoxy)-2-methylpropanoic acid (PubChem CID 10353214) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is (2S)-3-(4-chlorophenoxy)-2-methylpropanoic acid.
| Compound Name | (2S)-3-(4-chlorophenoxy)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 10353214 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (2S)-3-(4-chlorophenoxy)-2-methylpropanoic acid |
| SMILES | C[C@@H](COc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C10H11ClO3/c1-7(10(12)13)6-14-9-4-2-8(11)3-5-9/h2-5,7H,6H2,1H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | QBMLNKIBTFLJQG-ZETCQYMHSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |