C20H27N6O6P — CID 143173721
methyl 2-[[[4-(2-amino-6-oxo-1H-purin-9-yl)-2-methoxypentoxy]-phenoxyphosphanyl]amino]acetate (PubChem CID 143173721) has the molecular formula C20H27N6O6P and a molecular weight of 478.45 g/mol. Its IUPAC name is methyl 2-[[[4-(2-amino-6-oxo-1H-purin-9-yl)-2-methoxypentoxy]-phenoxyphosphanyl]amino]acetate.
| Compound Name | methyl 2-[[[4-(2-amino-6-oxo-1H-purin-9-yl)-2-methoxypentoxy]-phenoxyphosphanyl]amino]acetate |
|---|---|
| PubChem CID | 143173721 |
| Molecular Formula | C20H27N6O6P |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | methyl 2-[[[4-(2-amino-6-oxo-1H-purin-9-yl)-2-methoxypentoxy]-phenoxyphosphanyl]amino]acetate |
| SMILES | COC(=O)CNP(OCC(CC(C)n1cnc2c(=O)[nH]c(N)nc21)OC)Oc1ccccc1 |
| InChI | InChI=1S/C20H27N6O6P/c1-13(26-12-22-17-18(26)24-20(21)25-19(17)28)9-15(29-2)11-31-33(23-10-16(27)30-3)32-14-7-5-4-6-8-14/h4-8,12-13,15,23H,9-11H2,1-3H3,(H3,21,24,25,28) |
| InChIKey | UMKVRUSANGNTGC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|