C23H32ClN8O5PS — CID 143327157
methyl 2-[[[5-[2-amino-6-(2-methylsulfanylhydrazinyl)purin-9-yl]-4-methyloxolan-2-yl]methoxy-(4-chlorocyclohepta-1,3,5-trien-1-yl)oxyphosphanyl]amino]propanoate (PubChem CID 143327157) has the molecular formula C23H32ClN8O5PS and a molecular weight of 599.05 g/mol. Its IUPAC name is methyl 2-[[[5-[2-amino-6-(2-methylsulfanylhydrazinyl)purin-9-yl]-4-methyloxolan-2-yl]methoxy-(4-chlorocyclohepta-1,3,5-trien-1-yl)oxyphosphanyl]amino]propanoate.
| Compound Name | methyl 2-[[[5-[2-amino-6-(2-methylsulfanylhydrazinyl)purin-9-yl]-4-methyloxolan-2-yl]methoxy-(4-chlorocyclohepta-1,3,5-trien-1-yl)oxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 143327157 |
| Molecular Formula | C23H32ClN8O5PS |
| Molecular Weight | 599.05 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | methyl 2-[[[5-[2-amino-6-(2-methylsulfanylhydrazinyl)purin-9-yl]-4-methyloxolan-2-yl]methoxy-(4-chlorocyclohepta-1,3,5-trien-1-yl)oxyphosphanyl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(OCC1CC(C)C(n2cnc3c(NNSC)nc(N)nc32)O1)OC1=CC=C(Cl)C=CC1 |
| InChI | InChI=1S/C23H32ClN8O5PS/c1-13-10-17(36-21(13)32-12-26-18-19(29-31-39-4)27-23(25)28-20(18)32)11-35-38(30-14(2)22(33)34-3)37-16-7-5-6-15(24)8-9-16/h5-6,8-9,12-14,17,21,30-31H,7,10-11H2,1-4H3,(H3,25,27,28,29) |
| InChIKey | HMWZRWLAGHDRDQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 159.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.05 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|