C17H28N8O4 — CID 170602311
propan-2-yl 2-[2-[[5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methoxy]hydrazinyl]acetate (PubChem CID 170602311) has the molecular formula C17H28N8O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is propan-2-yl 2-[2-[[5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methoxy]hydrazinyl]acetate.
| Compound Name | propan-2-yl 2-[2-[[5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methoxy]hydrazinyl]acetate |
|---|---|
| PubChem CID | 170602311 |
| Molecular Formula | C17H28N8O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | propan-2-yl 2-[2-[[5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methoxy]hydrazinyl]acetate |
| SMILES | CNc1nc(N)nc2c1ncn2C1OC(CONNCC(=O)OC(C)C)CC1C |
| InChI | InChI=1S/C17H28N8O4/c1-9(2)28-12(26)6-21-24-27-7-11-5-10(3)16(29-11)25-8-20-13-14(19-4)22-17(18)23-15(13)25/h8-11,16,21,24H,5-7H2,1-4H3,(H3,18,19,22,23) |
| InChIKey | ZVQOSBLNHDPQPL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|