C24H32ClN8O8P — CID 143326950
methyl 2-[[[(3R,4R)-5-[2-amino-6-[amino(cyclopropyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 143326950) has the molecular formula C24H32ClN8O8P and a molecular weight of 627.00 g/mol. Its IUPAC name is methyl 2-[[[(3R,4R)-5-[2-amino-6-[amino(cyclopropyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[[(3R,4R)-5-[2-amino-6-[amino(cyclopropyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 143326950 |
| Molecular Formula | C24H32ClN8O8P |
| Molecular Weight | 627.00 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | methyl 2-[[[(3R,4R)-5-[2-amino-6-[amino(cyclopropyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OCC1OC(n2cnc3c(N(N)C4CC4)nc(N)nc32)[C@](C)(O)[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClN8O8P/c1-12(21(35)38-3)31-42(37,41-15-8-4-13(25)5-9-15)39-10-16-18(34)24(2,36)22(40-16)32-11-28-17-19(32)29-23(26)30-20(17)33(27)14-6-7-14/h4-5,8-9,11-12,14,16,18,22,34,36H,6-7,10,27H2,1-3H3,(H,31,37)(H2,26,29,30)/t12?,16?,18-,22?,24-,42?/m1/s1 |
| InChIKey | QSGILNMIMVGCAG-CPYPSGBRSA-N |
| XLogP | 1.27 |
| TPSA | 222.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.00 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|