C21H29N8O8P — CID 11989994
methyl (2S)-2-[[[(4R,5R)-5-[2-amino-6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 11989994) has the molecular formula C21H29N8O8P and a molecular weight of 552.49 g/mol. Its IUPAC name is methyl (2S)-2-[[[(4R,5R)-5-[2-amino-6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(4R,5R)-5-[2-amino-6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 11989994 |
| Molecular Formula | C21H29N8O8P |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | methyl (2S)-2-[[[(4R,5R)-5-[2-amino-6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(Oc1ccccc1)OC1O[C@@H](n2cnc3c(N(C)N)nc(N)nc32)[C@](C)(O)C1O |
| InChI | InChI=1S/C21H29N8O8P/c1-11(17(31)34-4)27-38(33,36-12-8-6-5-7-9-12)37-18-14(30)21(2,32)19(35-18)29-10-24-13-15(28(3)23)25-20(22)26-16(13)29/h5-11,14,18-19,30,32H,23H2,1-4H3,(H,27,33)(H2,22,25,26)/t11-,14?,18?,19+,21+,38?/m0/s1 |
| InChIKey | WNAQTMAFDJODPV-PSAUGMNSSA-N |
| XLogP | 0.04 |
| TPSA | 222.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|