C29H37N8O10PS — CID 75025638
benzyl 2-[[[5-[2-amino-6-[methanesulfonamido(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 75025638) has the molecular formula C29H37N8O10PS and a molecular weight of 720.70 g/mol. Its IUPAC name is benzyl 2-[[[5-[2-amino-6-[methanesulfonamido(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl 2-[[[5-[2-amino-6-[methanesulfonamido(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 75025638 |
| Molecular Formula | C29H37N8O10PS |
| Molecular Weight | 720.70 g/mol |
| Exact Mass | 720.21 |
| IUPAC Name | benzyl 2-[[[5-[2-amino-6-[methanesulfonamido(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OCC1OC(n2cnc3c(N(C)NS(C)(=O)=O)nc(N)nc32)C(C)(O)C1O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H37N8O10PS/c1-18(26(39)44-15-19-11-7-5-8-12-19)34-48(41,47-20-13-9-6-10-14-20)45-16-21-23(38)29(2,40)27(46-21)37-17-31-22-24(32-28(30)33-25(22)37)36(3)35-49(4,42)43/h5-14,17-18,21,23,27,35,38,40H,15-16H2,1-4H3,(H,34,41)(H2,30,32,33) |
| InChIKey | YPDUKNHIPPOPTA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 242.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.70 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|