C27H32ClN8O10PS — CID 11989995
benzyl 2-[[[(4R,5R)-5-[2-amino-6-[methanesulfonamido(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]oxy-(4-chlorophenoxy)phosphoryl]amino]acetate (PubChem CID 11989995) has the molecular formula C27H32ClN8O10PS and a molecular weight of 727.09 g/mol. Its IUPAC name is benzyl 2-[[[(4R,5R)-5-[2-amino-6-[methanesulfonamido(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]oxy-(4-chlorophenoxy)phosphoryl]amino]acetate.
| Compound Name | benzyl 2-[[[(4R,5R)-5-[2-amino-6-[methanesulfonamido(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]oxy-(4-chlorophenoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 11989995 |
| Molecular Formula | C27H32ClN8O10PS |
| Molecular Weight | 727.09 g/mol |
| Exact Mass | 726.14 |
| IUPAC Name | benzyl 2-[[[(4R,5R)-5-[2-amino-6-[methanesulfonamido(methyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]oxy-(4-chlorophenoxy)phosphoryl]amino]acetate |
| SMILES | CN(NS(C)(=O)=O)c1nc(N)nc2c1ncn2[C@@H]1OC(OP(=O)(NCC(=O)OCc2ccccc2)Oc2ccc(Cl)cc2)C(O)[C@@]1(C)O |
| InChI | InChI=1S/C27H32ClN8O10PS/c1-27(39)21(38)24(44-25(27)36-15-30-20-22(32-26(29)33-23(20)36)35(2)34-48(3,41)42)46-47(40,45-18-11-9-17(28)10-12-18)31-13-19(37)43-14-16-7-5-4-6-8-16/h4-12,15,21,24-25,34,38-39H,13-14H2,1-3H3,(H,31,40)(H2,29,32,33)/t21?,24?,25-,27-,47?/m1/s1 |
| InChIKey | QZOBKFYELCSPRJ-VXDZIIRESA-N |
| XLogP | 1.47 |
| TPSA | 242.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.09 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|