C25H34ClN8O8P — CID 143327246
methyl 1-[[[(3R,4R,5R)-5-[2-amino-6-[amino(ethyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]cyclobutane-1-carboxylate (PubChem CID 143327246) has the molecular formula C25H34ClN8O8P and a molecular weight of 641.02 g/mol. Its IUPAC name is methyl 1-[[[(3R,4R,5R)-5-[2-amino-6-[amino(ethyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[[[(3R,4R,5R)-5-[2-amino-6-[amino(ethyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 143327246 |
| Molecular Formula | C25H34ClN8O8P |
| Molecular Weight | 641.02 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | methyl 1-[[[(3R,4R,5R)-5-[2-amino-6-[amino(ethyl)amino]purin-9-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]cyclobutane-1-carboxylate |
| SMILES | CCN(N)c1nc(N)nc2c1ncn2[C@@H]1OC(COP(=O)(NC2(C(=O)OC)CCC2)Oc2ccc(Cl)cc2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C25H34ClN8O8P/c1-4-34(28)20-17-19(30-23(27)31-20)33(13-29-17)21-24(2,37)18(35)16(41-21)12-40-43(38,42-15-8-6-14(26)7-9-15)32-25(10-5-11-25)22(36)39-3/h6-9,13,16,18,21,35,37H,4-5,10-12,28H2,1-3H3,(H,32,38)(H2,27,30,31)/t16?,18-,21-,24-,43?/m1/s1 |
| InChIKey | AWIQYIWIAHVABA-IRIVLCPMSA-N |
| XLogP | 1.66 |
| TPSA | 222.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.02 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|