C24H30N7O6P — CID 166877398
methyl (2S)-2-[[[(2S,4R,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166877398) has the molecular formula C24H30N7O6P and a molecular weight of 543.52 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2S,4R,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2S,4R,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166877398 |
| Molecular Formula | C24H30N7O6P |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | methyl (2S)-2-[[[(2S,4R,5R)-5-[2-amino-6-(dimethylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@H]1C[C@@H](CO[P@](=O)(N[C@@H](C)C(=O)OC)Oc2ccccc2)O[C@H]1n1cnc2c(N(C)C)nc(N)nc21 |
| InChI | InChI=1S/C24H30N7O6P/c1-6-16-12-18(36-22(16)31-14-26-19-20(30(3)4)27-24(25)28-21(19)31)13-35-38(33,29-15(2)23(32)34-5)37-17-10-8-7-9-11-17/h1,7-11,14-16,18,22H,12-13H2,2-5H3,(H,29,33)(H2,25,27,28)/t15-,16-,18-,22+,38+/m0/s1 |
| InChIKey | DXDRIKWZPAWQBH-FWNXQQRASA-N |
| XLogP | 2.37 |
| TPSA | 155.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|