C23H29ClN7O4P — CID 143327331
1-[[[5-[6-[amino(methyl)amino]purin-9-yl]-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphanyl]amino]cyclobutane-1-carbaldehyde (PubChem CID 143327331) has the molecular formula C23H29ClN7O4P and a molecular weight of 533.96 g/mol. Its IUPAC name is 1-[[[5-[6-[amino(methyl)amino]purin-9-yl]-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphanyl]amino]cyclobutane-1-carbaldehyde.
| Compound Name | 1-[[[5-[6-[amino(methyl)amino]purin-9-yl]-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphanyl]amino]cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 143327331 |
| Molecular Formula | C23H29ClN7O4P |
| Molecular Weight | 533.96 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 1-[[[5-[6-[amino(methyl)amino]purin-9-yl]-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphanyl]amino]cyclobutane-1-carbaldehyde |
| SMILES | CC1CC(COP(NC2(C=O)CCC2)Oc2ccc(Cl)cc2)OC1n1cnc2c(N(C)N)ncnc21 |
| InChI | InChI=1S/C23H29ClN7O4P/c1-15-10-18(34-22(15)31-14-28-19-20(30(2)25)26-13-27-21(19)31)11-33-36(29-23(12-32)8-3-9-23)35-17-6-4-16(24)5-7-17/h4-7,12-15,18,22,29H,3,8-11,25H2,1-2H3 |
| InChIKey | KGNANYRDXIVWFR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.96 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|