C29H40ClN6O5PS — CID 143327336
propan-2-yl 2-[[(4-chlorophenoxy)-[[5-[4-[cyclopropyl-(methylsulfanylamino)amino]pyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methoxy]phosphanyl]amino]-2-methylpropanoate (PubChem CID 143327336) has the molecular formula C29H40ClN6O5PS and a molecular weight of 651.17 g/mol. Its IUPAC name is propan-2-yl 2-[[(4-chlorophenoxy)-[[5-[4-[cyclopropyl-(methylsulfanylamino)amino]pyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methoxy]phosphanyl]amino]-2-methylpropanoate.
| Compound Name | propan-2-yl 2-[[(4-chlorophenoxy)-[[5-[4-[cyclopropyl-(methylsulfanylamino)amino]pyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methoxy]phosphanyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 143327336 |
| Molecular Formula | C29H40ClN6O5PS |
| Molecular Weight | 651.17 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | propan-2-yl 2-[[(4-chlorophenoxy)-[[5-[4-[cyclopropyl-(methylsulfanylamino)amino]pyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methoxy]phosphanyl]amino]-2-methylpropanoate |
| SMILES | CSNN(c1ncnc2c1ccn2C1OC(COP(NC(C)(C)C(=O)OC(C)C)Oc2ccc(Cl)cc2)CC1C)C1CC1 |
| InChI | InChI=1S/C29H40ClN6O5PS/c1-18(2)39-28(37)29(4,5)33-42(41-22-11-7-20(30)8-12-22)38-16-23-15-19(3)27(40-23)35-14-13-24-25(35)31-17-32-26(24)36(34-43-6)21-9-10-21/h7-8,11-14,17-19,21,23,27,33-34H,9-10,15-16H2,1-6H3 |
| InChIKey | OODZFXZYPPMDBK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.17 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|