C24H34N9O8P — CID 70914668
ethyl (2S)-2-[[[(2R,3S)-2-[(1R)-1-(2-amino-6-ethoxypurin-9-yl)-2-azidoethoxy]-3-hydroxybutoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 70914668) has the molecular formula C24H34N9O8P and a molecular weight of 607.57 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S)-2-[(1R)-1-(2-amino-6-ethoxypurin-9-yl)-2-azidoethoxy]-3-hydroxybutoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S)-2-[(1R)-1-(2-amino-6-ethoxypurin-9-yl)-2-azidoethoxy]-3-hydroxybutoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 70914668 |
| Molecular Formula | C24H34N9O8P |
| Molecular Weight | 607.57 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S)-2-[(1R)-1-(2-amino-6-ethoxypurin-9-yl)-2-azidoethoxy]-3-hydroxybutoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@@H](O[C@H](CN=[N+]=[N-])n1cnc2c(OCC)nc(N)nc21)[C@H](C)O)Oc1ccccc1 |
| InChI | InChI=1S/C24H34N9O8P/c1-5-37-22-20-21(29-24(25)30-22)33(14-27-20)19(12-28-32-26)40-18(16(4)34)13-39-42(36,31-15(3)23(35)38-6-2)41-17-10-8-7-9-11-17/h7-11,14-16,18-19,34H,5-6,12-13H2,1-4H3,(H,31,36)(H2,25,29,30)/t15-,16-,18+,19+,42?/m0/s1 |
| InChIKey | NPRLFEKXKSJOGE-OWXUIOHZSA-N |
| XLogP | 3.13 |
| TPSA | 230.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|