C25H36FN6O8P — CID 122551731
propan-2-yl (2R)-2-[[2-[(1R,2R)-1-(2-amino-6-ethoxypurin-9-yl)-2-fluoro-3-hydroxy-2-methylpropoxy]ethoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 122551731) has the molecular formula C25H36FN6O8P and a molecular weight of 598.57 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[2-[(1R,2R)-1-(2-amino-6-ethoxypurin-9-yl)-2-fluoro-3-hydroxy-2-methylpropoxy]ethoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[2-[(1R,2R)-1-(2-amino-6-ethoxypurin-9-yl)-2-fluoro-3-hydroxy-2-methylpropoxy]ethoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122551731 |
| Molecular Formula | C25H36FN6O8P |
| Molecular Weight | 598.57 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | propan-2-yl (2R)-2-[[2-[(1R,2R)-1-(2-amino-6-ethoxypurin-9-yl)-2-fluoro-3-hydroxy-2-methylpropoxy]ethoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@H](OCCO[P@@](=O)(N[C@H](C)C(=O)OC(C)C)Oc1ccccc1)[C@](C)(F)CO |
| InChI | InChI=1S/C25H36FN6O8P/c1-6-36-21-19-20(29-24(27)30-21)32(15-28-19)23(25(5,26)14-33)37-12-13-38-41(35,40-18-10-8-7-9-11-18)31-17(4)22(34)39-16(2)3/h7-11,15-17,23,33H,6,12-14H2,1-5H3,(H,31,35)(H2,27,29,30)/t17-,23-,25-,41+/m1/s1 |
| InChIKey | OTTOKGZSMZIULA-JXYNTIOHSA-N |
| XLogP | 3.18 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|