About 1-methoxyethylbenzene;methyl formate;propane
1-methoxyethylbenzene;methyl formate;propane (PubChem CID 161186417) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is 1-methoxyethylbenzene;methyl formate;propane.
Molecular Properties
| Compound Name | 1-methoxyethylbenzene;methyl formate;propane |
| PubChem CID | 161186417 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-methoxyethylbenzene;methyl formate;propane |
| SMILES | CCC.COC(C)c1ccccc1.COC=O |
| InChI | InChI=1S/C9H12O.C3H8.C2H4O2/c1-8(10-2)9-6-4-3-5-7-9;1-3-2;1-4-2-3/h3-8H,1-2H3;3H2,1-2H3;2H,1H3 |
| InChIKey | UTDHPBWRXWMSEY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethylbenzene;methyl formate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethylbenzene;methyl formate;propane?
The IUPAC name of 1-methoxyethylbenzene;methyl formate;propane (CID 161186417) is 1-methoxyethylbenzene;methyl formate;propane.
What is the SMILES notation for 1-methoxyethylbenzene;methyl formate;propane?
The canonical SMILES for 1-methoxyethylbenzene;methyl formate;propane is CCC.COC(C)c1ccccc1.COC=O.
What is the InChIKey of 1-methoxyethylbenzene;methyl formate;propane?
The InChIKey is UTDHPBWRXWMSEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C3H8.C2H4O2/c1-8(10-2)9-6-4-3-5-7-9;1-3-2;1-4-2-3/h3-8H,1-2H3;3H2,1-2H3;2H,1H3.
What are the key properties of 1-methoxyethylbenzene;methyl formate;propane?
1-methoxyethylbenzene;methyl formate;propane has a molecular weight of 240.34 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethylbenzene;methyl formate;propane is sourced from PubChem (CID 161186417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).