C22H29FN3O5PS2 — CID 144807321
propan-2-yl 2-[[[5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-4-fluoro-4-methyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate (PubChem CID 144807321) has the molecular formula C22H29FN3O5PS2 and a molecular weight of 529.60 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-4-fluoro-4-methyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-4-fluoro-4-methyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 144807321 |
| Molecular Formula | C22H29FN3O5PS2 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | propan-2-yl 2-[[[5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-4-fluoro-4-methyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(OCC1CC(C)(F)C(n2ccc(=S)[nH]c2=S)O1)Oc1ccccc1 |
| InChI | InChI=1S/C22H29FN3O5PS2/c1-14(2)29-19(27)15(3)25-32(31-16-8-6-5-7-9-16)28-13-17-12-22(4,23)20(30-17)26-11-10-18(33)24-21(26)34/h5-11,14-15,17,20,25H,12-13H2,1-4H3,(H,24,33,34) |
| InChIKey | AAWRHLDCNVDZLT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|