C23H28F3N2O7PS2 — CID 161073568
propan-2-yl (2S)-3-[[(2S,3R,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-2,4-difluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 161073568) has the molecular formula C23H28F3N2O7PS2 and a molecular weight of 596.59 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[[(2S,3R,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-2,4-difluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[[(2S,3R,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-2,4-difluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 161073568 |
| Molecular Formula | C23H28F3N2O7PS2 |
| Molecular Weight | 596.59 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | propan-2-yl (2S)-3-[[(2S,3R,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-2,4-difluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | CC(C)OC(=O)[C@H](C)CP(=O)(OC[C@@]1(F)O[C@@H](n2ccc(=S)[nH]c2=S)C(F)(CF)[C@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H28F3N2O7PS2/c1-14(2)33-18(29)15(3)11-36(31,35-16-7-5-4-6-8-16)32-13-23(26)19(30)22(25,12-24)20(34-23)28-10-9-17(37)27-21(28)38/h4-10,14-15,19-20,30H,11-13H2,1-3H3,(H,27,37,38)/t15-,19-,20-,22?,23-,36?/m1/s1 |
| InChIKey | DSXVKKFQPWASQC-KKESYIJGSA-N |
| XLogP | 5.38 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|