C18H22N2O8 — CID 130198016
[(5S)-4,5-diacetyloxy-6-(3-carbamoyl-4H-pyridin-1-yl)-2-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate (PubChem CID 130198016) has the molecular formula C18H22N2O8 and a molecular weight of 394.38 g/mol. Its IUPAC name is [(5S)-4,5-diacetyloxy-6-(3-carbamoyl-4H-pyridin-1-yl)-2-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate.
| Compound Name | [(5S)-4,5-diacetyloxy-6-(3-carbamoyl-4H-pyridin-1-yl)-2-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 130198016 |
| Molecular Formula | C18H22N2O8 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [(5S)-4,5-diacetyloxy-6-(3-carbamoyl-4H-pyridin-1-yl)-2-oxabicyclo[3.1.0]hexan-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC2C(N3C=CCC(C(N)=O)=C3)[C@@]2(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H22N2O8/c1-9(21)25-8-13-15(26-10(2)22)18(28-11(3)23)14(16(18)27-13)20-6-4-5-12(7-20)17(19)24/h4,6-7,13-16H,5,8H2,1-3H3,(H2,19,24)/t13?,14?,15?,16?,18-/m1/s1 |
| InChIKey | WFBQBGKYNJLJKY-ZHEFSGTFSA-N |
| XLogP | -0.48 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|