C20H37N4O8PS — CID 161082228
O-[(2R,3S,5R)-5-(deuteriomethyl)-2-(2,4-dioxopyrimidin-1-yl)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyoxolan-3-yl] N-methoxy-N-methylcarbamothioate;tritiooxymethane (PubChem CID 161082228) has the molecular formula C20H37N4O8PS and a molecular weight of 527.59 g/mol. Its IUPAC name is O-[(2R,3S,5R)-5-(deuteriomethyl)-2-(2,4-dioxopyrimidin-1-yl)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyoxolan-3-yl] N-methoxy-N-methylcarbamothioate;tritiooxymethane.
| Compound Name | O-[(2R,3S,5R)-5-(deuteriomethyl)-2-(2,4-dioxopyrimidin-1-yl)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyoxolan-3-yl] N-methoxy-N-methylcarbamothioate;tritiooxymethane |
|---|---|
| PubChem CID | 161082228 |
| Molecular Formula | C20H37N4O8PS |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | O-[(2R,3S,5R)-5-(deuteriomethyl)-2-(2,4-dioxopyrimidin-1-yl)-4-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyoxolan-3-yl] N-methoxy-N-methylcarbamothioate;tritiooxymethane |
| SMILES | [2H]C[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](OC(=S)N(C)OC)C1OP(OC)N(C(C)C)C(C)C.[3H]OC |
| InChI | InChI=1S/C19H33N4O7PS.CH4O/c1-11(2)23(12(3)4)31(27-8)30-15-13(5)28-17(16(15)29-19(32)21(6)26-7)22-10-9-14(24)20-18(22)25;1-2/h9-13,15-17H,1-8H3,(H,20,24,25);2H,1H3/t13-,15?,16+,17-,31?;/m1./s1/i5D;2T |
| InChIKey | UGBFWWCQDWOSDE-VMTWLBJISA-N |
| XLogP | 1.60 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|