C23H37N4O8P — CID 153419796
methyl 3-[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-4-methoxyoxolan-2-yl]-2-methylpropanoate (PubChem CID 153419796) has the molecular formula C23H37N4O8P and a molecular weight of 528.54 g/mol. Its IUPAC name is methyl 3-[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-4-methoxyoxolan-2-yl]-2-methylpropanoate.
| Compound Name | methyl 3-[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-4-methoxyoxolan-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 153419796 |
| Molecular Formula | C23H37N4O8P |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | methyl 3-[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-4-methoxyoxolan-2-yl]-2-methylpropanoate |
| SMILES | [C-]#[N+]CCOP(OC1[C@@H](CC(C)C(=O)OC)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H]1OC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H37N4O8P/c1-14(2)27(15(3)4)36(33-12-10-24-6)35-19-17(13-16(5)22(29)32-8)34-21(20(19)31-7)26-11-9-18(28)25-23(26)30/h9,11,14-17,19-21H,10,12-13H2,1-5,7-8H3,(H,25,28,30)/t16?,17-,19?,20+,21-,36?/m1/s1 |
| InChIKey | XZCAVCWICQSPPJ-FPOYXZDISA-N |
| XLogP | 2.31 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|