C27H36N5O6P — CID 159187248
N-[1-[(1S,3R,7R)-1-(deuteriomethyl)-7-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide (PubChem CID 159187248) has the molecular formula C27H36N5O6P and a molecular weight of 558.59 g/mol. Its IUPAC name is N-[1-[(1S,3R,7R)-1-(deuteriomethyl)-7-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(1S,3R,7R)-1-(deuteriomethyl)-7-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 159187248 |
| Molecular Formula | C27H36N5O6P |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | N-[1-[(1S,3R,7R)-1-(deuteriomethyl)-7-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide |
| SMILES | [2H]C[C@@]12COC([C@H](n3cc(C)c(NC(=O)c4ccccc4)nc3=O)O1)[C@H]2OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C27H36N5O6P/c1-17(2)32(18(3)4)39(36-14-13-28-7)38-22-21-25(37-27(22,6)16-35-21)31-15-19(5)23(30-26(31)34)29-24(33)20-11-9-8-10-12-20/h8-12,15,17-18,21-22,25H,13-14,16H2,1-6H3,(H,29,30,33,34)/t21?,22-,25-,27+,39?/m1/s1/i6D |
| InChIKey | XKRJXRVBYMELJG-KFRIQTRSSA-N |
| XLogP | 4.16 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|