C28H37FN7O5P — CID 158314216
N-[9-[(2R,3R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyl-3-methoxyoxolan-2-yl]-2-fluoropurin-6-yl]benzamide (PubChem CID 158314216) has the molecular formula C28H37FN7O5P and a molecular weight of 601.62 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyl-3-methoxyoxolan-2-yl]-2-fluoropurin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyl-3-methoxyoxolan-2-yl]-2-fluoropurin-6-yl]benzamide |
|---|---|
| PubChem CID | 158314216 |
| Molecular Formula | C28H37FN7O5P |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-5-ethyl-3-methoxyoxolan-2-yl]-2-fluoropurin-6-yl]benzamide |
| SMILES | [C-]#[N+]CCOP(O[C@H]1[C@@H](OC)[C@H](n2cnc3c(NC(=O)c4ccccc4)nc(F)nc32)O[C@@H]1CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C28H37FN7O5P/c1-8-20-22(41-42(39-15-14-30-6)36(17(2)3)18(4)5)23(38-7)27(40-20)35-16-31-21-24(33-28(29)34-25(21)35)32-26(37)19-12-10-9-11-13-19/h9-13,16-18,20,22-23,27H,8,14-15H2,1-5,7H3,(H,32,33,34,37)/t20-,22-,23-,27-,42?/m1/s1 |
| InChIKey | GOBCSFLHXNWFKJ-JXADKLCLSA-N |
| XLogP | 5.21 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|