C25H44FN2O9P — CID 160906580
1-[5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phosphanyl]oxy-3-fluorooxolan-2-yl]pyridine-2,4-dione (PubChem CID 160906580) has the molecular formula C25H44FN2O9P and a molecular weight of 567.61 g/mol. Its IUPAC name is 1-[5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phosphanyl]oxy-3-fluorooxolan-2-yl]pyridine-2,4-dione.
| Compound Name | 1-[5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phosphanyl]oxy-3-fluorooxolan-2-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 160906580 |
| Molecular Formula | C25H44FN2O9P |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 1-[5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phosphanyl]oxy-3-fluorooxolan-2-yl]pyridine-2,4-dione |
| SMILES | [2H]CC1OC(N2C=CC(=O)CC2=O)C(F)C1OP(OCCOCCOCCOCCOC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C25H44FN2O9P/c1-18(2)28(19(3)4)38(35-16-15-34-14-13-33-12-11-32-10-9-31-6)37-24-20(5)36-25(23(24)26)27-8-7-21(29)17-22(27)30/h7-8,18-20,23-25H,9-17H2,1-6H3/i5D |
| InChIKey | CJEWUBCQTDVGDZ-UICOGKGYSA-N |
| XLogP | 2.83 |
| TPSA | 105.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|