C16H29N2O3PS — CID 140608131
N-[[(1R,3S,4S,6S,7R)-1-(deuteriomethyl)-6-methyl-3-tritio-2-oxa-5-thiabicyclo[2.2.1]heptan-7-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 140608131) has the molecular formula C16H29N2O3PS and a molecular weight of 363.47 g/mol. Its IUPAC name is N-[[(1R,3S,4S,6S,7R)-1-(deuteriomethyl)-6-methyl-3-tritio-2-oxa-5-thiabicyclo[2.2.1]heptan-7-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[(1R,3S,4S,6S,7R)-1-(deuteriomethyl)-6-methyl-3-tritio-2-oxa-5-thiabicyclo[2.2.1]heptan-7-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 140608131 |
| Molecular Formula | C16H29N2O3PS |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-[[(1R,3S,4S,6S,7R)-1-(deuteriomethyl)-6-methyl-3-tritio-2-oxa-5-thiabicyclo[2.2.1]heptan-7-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | [2H]C[C@]12O[C@@H]([3H])[C@H](S[C@H]1C)[C@@H]2OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H29N2O3PS/c1-11(2)18(12(3)4)22(20-9-8-17-7)21-15-14-10-19-16(15,6)13(5)23-14/h11-15H,8-10H2,1-6H3/t13-,14-,15-,16-,22?/m0/s1/i6D,10T/t10-,13-,14-,15-,16-,22? |
| InChIKey | JBKMAFUIYUWTRR-IVMMIHHZSA-N |
| XLogP | 3.95 |
| TPSA | 35.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|